C15H18N2O — CID 139771077
N-ethyl-4-phenyl-4,5,6,7-tetrahydro-2,1-benzoxazol-3-amine (PubChem CID 139771077) has the molecular formula C15H18N2O and a molecular weight of 242.32 g/mol. Its IUPAC name is N-ethyl-4-phenyl-4,5,6,7-tetrahydro-2,1-benzoxazol-3-amine.
| Compound Name | N-ethyl-4-phenyl-4,5,6,7-tetrahydro-2,1-benzoxazol-3-amine |
|---|---|
| PubChem CID | 139771077 |
| Molecular Formula | C15H18N2O |
| Molecular Weight | 242.32 g/mol |
| Exact Mass | 242.14 |
| IUPAC Name | N-ethyl-4-phenyl-4,5,6,7-tetrahydro-2,1-benzoxazol-3-amine |
| SMILES | CCNc1onc2c1C(c1ccccc1)CCC2 |
| InChI | InChI=1S/C15H18N2O/c1-2-16-15-14-12(11-7-4-3-5-8-11)9-6-10-13(14)17-18-15/h3-5,7-8,12,16H,2,6,9-10H2,1H3 |
| InChIKey | VUPBPLFTCRQFHM-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 38.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.32 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |