About butyl 5-methyl-2,4-dioxopyrimidine-1-carboxylate
butyl 5-methyl-2,4-dioxopyrimidine-1-carboxylate (PubChem CID 139771313) has the molecular formula C10H14N2O4
and a molecular weight of 226.23 g/mol. Its IUPAC name is butyl 5-methyl-2,4-dioxopyrimidine-1-carboxylate.
Molecular Properties
| Compound Name | butyl 5-methyl-2,4-dioxopyrimidine-1-carboxylate |
| PubChem CID | 139771313 |
| Molecular Formula | C10H14N2O4 |
| Molecular Weight | 226.23 g/mol |
| Exact Mass | 226.10 |
| IUPAC Name | butyl 5-methyl-2,4-dioxopyrimidine-1-carboxylate |
| SMILES | CCCCOC(=O)n1cc(C)c(=O)[nH]c1=O |
| InChI | InChI=1S/C10H14N2O4/c1-3-4-5-16-10(15)12-6-7(2)8(13)11-9(12)14/h6H,3-5H2,1-2H3,(H,11,13,14) |
| InChIKey | QDDSOSDQULPEFQ-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 81.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.23 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze butyl 5-methyl-2,4-dioxopyrimidine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butyl 5-methyl-2,4-dioxopyrimidine-1-carboxylate?
The IUPAC name of butyl 5-methyl-2,4-dioxopyrimidine-1-carboxylate (CID 139771313) is butyl 5-methyl-2,4-dioxopyrimidine-1-carboxylate.
What is the SMILES notation for butyl 5-methyl-2,4-dioxopyrimidine-1-carboxylate?
The canonical SMILES for butyl 5-methyl-2,4-dioxopyrimidine-1-carboxylate is CCCCOC(=O)n1cc(C)c(=O)[nH]c1=O.
What is the InChIKey of butyl 5-methyl-2,4-dioxopyrimidine-1-carboxylate?
The InChIKey is QDDSOSDQULPEFQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14N2O4/c1-3-4-5-16-10(15)12-6-7(2)8(13)11-9(12)14/h6H,3-5H2,1-2H3,(H,11,13,14).
What are the key properties of butyl 5-methyl-2,4-dioxopyrimidine-1-carboxylate?
butyl 5-methyl-2,4-dioxopyrimidine-1-carboxylate has a molecular weight of 226.23 g/mol, XLogP of 0.63, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for butyl 5-methyl-2,4-dioxopyrimidine-1-carboxylate is sourced from PubChem (CID 139771313), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).