C16H20O5 — CID 139771422
2-[(4-methoxycarbonylphenyl)methyl]-6-oxoheptanoic acid (PubChem CID 139771422) has the molecular formula C16H20O5 and a molecular weight of 292.33 g/mol. Its IUPAC name is 2-[(4-methoxycarbonylphenyl)methyl]-6-oxoheptanoic acid.
| Compound Name | 2-[(4-methoxycarbonylphenyl)methyl]-6-oxoheptanoic acid |
|---|---|
| PubChem CID | 139771422 |
| Molecular Formula | C16H20O5 |
| Molecular Weight | 292.33 g/mol |
| Exact Mass | 292.13 |
| IUPAC Name | 2-[(4-methoxycarbonylphenyl)methyl]-6-oxoheptanoic acid |
| SMILES | COC(=O)c1ccc(CC(CCCC(C)=O)C(=O)O)cc1 |
| InChI | InChI=1S/C16H20O5/c1-11(17)4-3-5-14(15(18)19)10-12-6-8-13(9-7-12)16(20)21-2/h6-9,14H,3-5,10H2,1-2H3,(H,18,19) |
| InChIKey | ICUDNBKLDMMYIG-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.33 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |