C21H42N2O — CID 139771507
(9Z,12Z)-1-(3-aminopropylamino)octadeca-9,12-dien-3-ol (PubChem CID 139771507) has the molecular formula C21H42N2O and a molecular weight of 338.58 g/mol. Its IUPAC name is (9Z,12Z)-1-(3-aminopropylamino)octadeca-9,12-dien-3-ol.
| Compound Name | (9Z,12Z)-1-(3-aminopropylamino)octadeca-9,12-dien-3-ol |
|---|---|
| PubChem CID | 139771507 |
| Molecular Formula | C21H42N2O |
| Molecular Weight | 338.58 g/mol |
| Exact Mass | 338.33 |
| IUPAC Name | (9Z,12Z)-1-(3-aminopropylamino)octadeca-9,12-dien-3-ol |
| SMILES | CCCCC/C=C\C/C=C\CCCCCC(O)CCNCCCN |
| InChI | InChI=1S/C21H42N2O/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-16-21(24)17-20-23-19-15-18-22/h6-7,9-10,21,23-24H,2-5,8,11-20,22H2,1H3/b7-6-,10-9- |
| InChIKey | QAXORIQBJGKAGA-HZJYTTRNSA-N |
| XLogP | 4.71 |
| TPSA | 58.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.58 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|