C29H30O3 — CID 139772826
(8S,11R,13S,14S,17S)-11-(4-acetylphenyl)-17-ethynyl-17-hydroxy-13,16-dimethyl-1,2,6,7,8,11,12,14-octahydrocyclopenta[a]phenanthren-3-one (PubChem CID 139772826) has the molecular formula C29H30O3 and a molecular weight of 426.56 g/mol. Its IUPAC name is (8S,11R,13S,14S,17S)-11-(4-acetylphenyl)-17-ethynyl-17-hydroxy-13,16-dimethyl-1,2,6,7,8,11,12,14-octahydrocyclopenta[a]phenanthren-3-one.
| Compound Name | (8S,11R,13S,14S,17S)-11-(4-acetylphenyl)-17-ethynyl-17-hydroxy-13,16-dimethyl-1,2,6,7,8,11,12,14-octahydrocyclopenta[a]phenanthren-3-one |
|---|---|
| PubChem CID | 139772826 |
| Molecular Formula | C29H30O3 |
| Molecular Weight | 426.56 g/mol |
| Exact Mass | 426.22 |
| IUPAC Name | (8S,11R,13S,14S,17S)-11-(4-acetylphenyl)-17-ethynyl-17-hydroxy-13,16-dimethyl-1,2,6,7,8,11,12,14-octahydrocyclopenta[a]phenanthren-3-one |
| SMILES | C#C[C@]1(O)C(C)=C[C@H]2[C@@H]3CCC4=CC(=O)CCC4=C3[C@@H](c3ccc(C(C)=O)cc3)C[C@@]21C |
| InChI | InChI=1S/C29H30O3/c1-5-29(32)17(2)14-26-24-12-10-21-15-22(31)11-13-23(21)27(24)25(16-28(26,29)4)20-8-6-19(7-9-20)18(3)30/h1,6-9,14-15,24-26,32H,10-13,16H2,2-4H3/t24-,25+,26-,28-,29-/m0/s1 |
| InChIKey | XHAHTVOVTGXUTO-GCNJZUOMSA-N |
| XLogP | 5.32 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.56 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|