C17H26 — CID 139772831
3,3-dimethyl-6,7-di(propan-2-yl)-1,2-dihydroindene (PubChem CID 139772831) has the molecular formula C17H26 and a molecular weight of 230.39 g/mol. Its IUPAC name is 3,3-dimethyl-6,7-di(propan-2-yl)-1,2-dihydroindene.
| Compound Name | 3,3-dimethyl-6,7-di(propan-2-yl)-1,2-dihydroindene |
|---|---|
| PubChem CID | 139772831 |
| Molecular Formula | C17H26 |
| Molecular Weight | 230.39 g/mol |
| Exact Mass | 230.20 |
| IUPAC Name | 3,3-dimethyl-6,7-di(propan-2-yl)-1,2-dihydroindene |
| SMILES | CC(C)c1ccc2c(c1C(C)C)CCC2(C)C |
| InChI | InChI=1S/C17H26/c1-11(2)13-7-8-15-14(16(13)12(3)4)9-10-17(15,5)6/h7-8,11-12H,9-10H2,1-6H3 |
| InChIKey | AJRTXTQNRAOQJZ-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.39 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |