C27H23NO8 — CID 139773010
1-benzyl-2,5-bis(4-hydroxy-3-methoxyphenyl)pyrrole-3,4-dicarboxylic acid (PubChem CID 139773010) has the molecular formula C27H23NO8 and a molecular weight of 489.48 g/mol. Its IUPAC name is 1-benzyl-2,5-bis(4-hydroxy-3-methoxyphenyl)pyrrole-3,4-dicarboxylic acid.
| Compound Name | 1-benzyl-2,5-bis(4-hydroxy-3-methoxyphenyl)pyrrole-3,4-dicarboxylic acid |
|---|---|
| PubChem CID | 139773010 |
| Molecular Formula | C27H23NO8 |
| Molecular Weight | 489.48 g/mol |
| Exact Mass | 489.14 |
| IUPAC Name | 1-benzyl-2,5-bis(4-hydroxy-3-methoxyphenyl)pyrrole-3,4-dicarboxylic acid |
| SMILES | COc1cc(-c2c(C(=O)O)c(C(=O)O)c(-c3ccc(O)c(OC)c3)n2Cc2ccccc2)ccc1O |
| InChI | InChI=1S/C27H23NO8/c1-35-20-12-16(8-10-18(20)29)24-22(26(31)32)23(27(33)34)25(17-9-11-19(30)21(13-17)36-2)28(24)14-15-6-4-3-5-7-15/h3-13,29-30H,14H2,1-2H3,(H,31,32)(H,33,34) |
| InChIKey | IPVLCMKPGXLVCT-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 138.45 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.48 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |