C12H16 — CID 139773334
pentacyclo[5.4.1.01,3.05,9.08,11]dodecane (PubChem CID 139773334) has the molecular formula C12H16 and a molecular weight of 160.26 g/mol. Its IUPAC name is pentacyclo[5.4.1.01,3.05,9.08,11]dodecane.
| Compound Name | pentacyclo[5.4.1.01,3.05,9.08,11]dodecane |
|---|---|
| PubChem CID | 139773334 |
| Molecular Formula | C12H16 |
| Molecular Weight | 160.26 g/mol |
| Exact Mass | 160.13 |
| IUPAC Name | pentacyclo[5.4.1.01,3.05,9.08,11]dodecane |
| SMILES | C1C2CC3CC34CC1C1C2CC14 |
| InChI | InChI=1S/C12H16/c1-6-2-8-5-12(8)4-7(1)11-9(6)3-10(11)12/h6-11H,1-5H2 |
| InChIKey | GJFJKEWYWYIUEM-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 160.26 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |