C21H20N6O3S — CID 139773533
ethyl 2-[3-[2-(4-cyclobutyl-1,3-thiazol-2-yl)ethynyl]-N-(2H-tetrazole-5-carbonyl)anilino]acetate (PubChem CID 139773533) has the molecular formula C21H20N6O3S and a molecular weight of 436.50 g/mol. Its IUPAC name is ethyl 2-[3-[2-(4-cyclobutyl-1,3-thiazol-2-yl)ethynyl]-N-(2H-tetrazole-5-carbonyl)anilino]acetate.
| Compound Name | ethyl 2-[3-[2-(4-cyclobutyl-1,3-thiazol-2-yl)ethynyl]-N-(2H-tetrazole-5-carbonyl)anilino]acetate |
|---|---|
| PubChem CID | 139773533 |
| Molecular Formula | C21H20N6O3S |
| Molecular Weight | 436.50 g/mol |
| Exact Mass | 436.13 |
| IUPAC Name | ethyl 2-[3-[2-(4-cyclobutyl-1,3-thiazol-2-yl)ethynyl]-N-(2H-tetrazole-5-carbonyl)anilino]acetate |
| SMILES | CCOC(=O)CN(C(=O)c1nn[nH]n1)c1cccc(C#Cc2nc(C3CCC3)cs2)c1 |
| InChI | InChI=1S/C21H20N6O3S/c1-2-30-19(28)12-27(21(29)20-23-25-26-24-20)16-8-3-5-14(11-16)9-10-18-22-17(13-31-18)15-6-4-7-15/h3,5,8,11,13,15H,2,4,6-7,12H2,1H3,(H,23,24,25,26) |
| InChIKey | VLXBEARZXTWMRR-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 113.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.50 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|