C15H12I2N4O — CID 139773840
5-(3,5-diiodophenyl)-2-[(4-methoxyphenyl)methyl]tetrazole (PubChem CID 139773840) has the molecular formula C15H12I2N4O and a molecular weight of 518.10 g/mol. Its IUPAC name is 5-(3,5-diiodophenyl)-2-[(4-methoxyphenyl)methyl]tetrazole.
| Compound Name | 5-(3,5-diiodophenyl)-2-[(4-methoxyphenyl)methyl]tetrazole |
|---|---|
| PubChem CID | 139773840 |
| Molecular Formula | C15H12I2N4O |
| Molecular Weight | 518.10 g/mol |
| Exact Mass | 517.91 |
| IUPAC Name | 5-(3,5-diiodophenyl)-2-[(4-methoxyphenyl)methyl]tetrazole |
| SMILES | COc1ccc(Cn2nnc(-c3cc(I)cc(I)c3)n2)cc1 |
| InChI | InChI=1S/C15H12I2N4O/c1-22-14-4-2-10(3-5-14)9-21-19-15(18-20-21)11-6-12(16)8-13(17)7-11/h2-8H,9H2,1H3 |
| InChIKey | BYIOJVGDAFYVAH-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 52.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.10 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|