C22H24F8OSi — CID 139774066
(4-butyl-2,3,5,6-tetrafluorophenoxy)-(4-butyl-2,3,5,6-tetrafluorophenyl)-dimethylsilane (PubChem CID 139774066) has the molecular formula C22H24F8OSi and a molecular weight of 484.50 g/mol. Its IUPAC name is (4-butyl-2,3,5,6-tetrafluorophenoxy)-(4-butyl-2,3,5,6-tetrafluorophenyl)-dimethylsilane.
| Compound Name | (4-butyl-2,3,5,6-tetrafluorophenoxy)-(4-butyl-2,3,5,6-tetrafluorophenyl)-dimethylsilane |
|---|---|
| PubChem CID | 139774066 |
| Molecular Formula | C22H24F8OSi |
| Molecular Weight | 484.50 g/mol |
| Exact Mass | 484.15 |
| IUPAC Name | (4-butyl-2,3,5,6-tetrafluorophenoxy)-(4-butyl-2,3,5,6-tetrafluorophenyl)-dimethylsilane |
| SMILES | CCCCc1c(F)c(F)c(O[Si](C)(C)c2c(F)c(F)c(CCCC)c(F)c2F)c(F)c1F |
| InChI | InChI=1S/C22H24F8OSi/c1-5-7-9-11-13(23)17(27)21(18(28)14(11)24)31-32(3,4)22-19(29)15(25)12(10-8-6-2)16(26)20(22)30/h5-10H2,1-4H3 |
| InChIKey | BBUCVGXWDKFQQW-UHFFFAOYSA-N |
| XLogP | 6.98 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.50 |
| LogP ≤ 5 | 6.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|