C24H32BrN5O5 — CID 139774173
(4R)-3-[4-[[2-[[(2S)-3-(3-bromo-3-nitrocyclohexa-1,5-dien-1-yl)oxy-2-hydroxypropyl]amino]-2-methylpropyl]amino]phenyl]-4-methyl-4,5-dihydro-1H-pyridazin-6-one (PubChem CID 139774173) has the molecular formula C24H32BrN5O5 and a molecular weight of 550.45 g/mol. Its IUPAC name is (4R)-3-[4-[[2-[[(2S)-3-(3-bromo-3-nitrocyclohexa-1,5-dien-1-yl)oxy-2-hydroxypropyl]amino]-2-methylpropyl]amino]phenyl]-4-methyl-4,5-dihydro-1H-pyridazin-6-one.
| Compound Name | (4R)-3-[4-[[2-[[(2S)-3-(3-bromo-3-nitrocyclohexa-1,5-dien-1-yl)oxy-2-hydroxypropyl]amino]-2-methylpropyl]amino]phenyl]-4-methyl-4,5-dihydro-1H-pyridazin-6-one |
|---|---|
| PubChem CID | 139774173 |
| Molecular Formula | C24H32BrN5O5 |
| Molecular Weight | 550.45 g/mol |
| Exact Mass | 549.16 |
| IUPAC Name | (4R)-3-[4-[[2-[[(2S)-3-(3-bromo-3-nitrocyclohexa-1,5-dien-1-yl)oxy-2-hydroxypropyl]amino]-2-methylpropyl]amino]phenyl]-4-methyl-4,5-dihydro-1H-pyridazin-6-one |
| SMILES | C[C@@H]1CC(=O)NN=C1c1ccc(NCC(C)(C)NC[C@H](O)COC2=CC(Br)([N+](=O)[O-])CC=C2)cc1 |
| InChI | InChI=1S/C24H32BrN5O5/c1-16-11-21(32)28-29-22(16)17-6-8-18(9-7-17)26-15-23(2,3)27-13-19(31)14-35-20-5-4-10-24(25,12-20)30(33)34/h4-9,12,16,19,26-27,31H,10-11,13-15H2,1-3H3,(H,28,32)/t16-,19+,24?/m1/s1 |
| InChIKey | YXWSVQIYOCBSMH-OFYJWOHPSA-N |
| XLogP | 2.92 |
| TPSA | 138.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.45 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|