C16H16O3 — CID 139774652
2,2,5-trimethylbenzo[h]chromene-4,6-diol (PubChem CID 139774652) has the molecular formula C16H16O3 and a molecular weight of 256.30 g/mol. Its IUPAC name is 2,2,5-trimethylbenzo[h]chromene-4,6-diol.
| Compound Name | 2,2,5-trimethylbenzo[h]chromene-4,6-diol |
|---|---|
| PubChem CID | 139774652 |
| Molecular Formula | C16H16O3 |
| Molecular Weight | 256.30 g/mol |
| Exact Mass | 256.11 |
| IUPAC Name | 2,2,5-trimethylbenzo[h]chromene-4,6-diol |
| SMILES | Cc1c2c(c3ccccc3c1O)OC(C)(C)C=C2O |
| InChI | InChI=1S/C16H16O3/c1-9-13-12(17)8-16(2,3)19-15(13)11-7-5-4-6-10(11)14(9)18/h4-8,17-18H,1-3H3 |
| InChIKey | WXKCKZSHNSEVML-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.30 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |