About N-[3-hydroxy-2-[2-(1-methylindol-2-yl)ethenyl]phenyl]-2,2-dimethylpropanamide
N-[3-hydroxy-2-[2-(1-methylindol-2-yl)ethenyl]phenyl]-2,2-dimethylpropanamide (PubChem CID 139775325) has the molecular formula C22H24N2O2
and a molecular weight of 348.45 g/mol. Its IUPAC name is N-[3-hydroxy-2-[2-(1-methylindol-2-yl)ethenyl]phenyl]-2,2-dimethylpropanamide.
Molecular Properties
| Compound Name | N-[3-hydroxy-2-[2-(1-methylindol-2-yl)ethenyl]phenyl]-2,2-dimethylpropanamide |
| PubChem CID | 139775325 |
| Molecular Formula | C22H24N2O2 |
| Molecular Weight | 348.45 g/mol |
| Exact Mass | 348.18 |
| IUPAC Name | N-[3-hydroxy-2-[2-(1-methylindol-2-yl)ethenyl]phenyl]-2,2-dimethylpropanamide |
| SMILES | Cn1c(C=Cc2c(O)cccc2NC(=O)C(C)(C)C)cc2ccccc21 |
| InChI | InChI=1S/C22H24N2O2/c1-22(2,3)21(26)23-18-9-7-11-20(25)17(18)13-12-16-14-15-8-5-6-10-19(15)24(16)4/h5-14,25H,1-4H3,(H,23,26) |
| InChIKey | CHWZDZMTQVWSJW-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 54.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 348.45 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'} |
|---|
Analyze N-[3-hydroxy-2-[2-(1-methylindol-2-yl)ethenyl]phenyl]-2,2-dimethylpropanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[3-hydroxy-2-[2-(1-methylindol-2-yl)ethenyl]phenyl]-2,2-dimethylpropanamide?
The IUPAC name of N-[3-hydroxy-2-[2-(1-methylindol-2-yl)ethenyl]phenyl]-2,2-dimethylpropanamide (CID 139775325) is N-[3-hydroxy-2-[2-(1-methylindol-2-yl)ethenyl]phenyl]-2,2-dimethylpropanamide.
What is the SMILES notation for N-[3-hydroxy-2-[2-(1-methylindol-2-yl)ethenyl]phenyl]-2,2-dimethylpropanamide?
The canonical SMILES for N-[3-hydroxy-2-[2-(1-methylindol-2-yl)ethenyl]phenyl]-2,2-dimethylpropanamide is Cn1c(C=Cc2c(O)cccc2NC(=O)C(C)(C)C)cc2ccccc21.
What is the InChIKey of N-[3-hydroxy-2-[2-(1-methylindol-2-yl)ethenyl]phenyl]-2,2-dimethylpropanamide?
The InChIKey is CHWZDZMTQVWSJW-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H24N2O2/c1-22(2,3)21(26)23-18-9-7-11-20(25)17(18)13-12-16-14-15-8-5-6-10-19(15)24(16)4/h5-14,25H,1-4H3,(H,23,26).
What are the key properties of N-[3-hydroxy-2-[2-(1-methylindol-2-yl)ethenyl]phenyl]-2,2-dimethylpropanamide?
N-[3-hydroxy-2-[2-(1-methylindol-2-yl)ethenyl]phenyl]-2,2-dimethylpropanamide has a molecular weight of 348.45 g/mol, XLogP of 5.04, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[3-hydroxy-2-[2-(1-methylindol-2-yl)ethenyl]phenyl]-2,2-dimethylpropanamide is sourced from PubChem (CID 139775325), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).