About 5-hydroxy-3,3-bis(2-hydroxyethyl)-1-(methylamino)pentane-1-sulfonic acid
5-hydroxy-3,3-bis(2-hydroxyethyl)-1-(methylamino)pentane-1-sulfonic acid (PubChem CID 139775812) has the molecular formula C10H23NO6S
and a molecular weight of 285.36 g/mol. Its IUPAC name is 5-hydroxy-3,3-bis(2-hydroxyethyl)-1-(methylamino)pentane-1-sulfonic acid.
Molecular Properties
| Compound Name | 5-hydroxy-3,3-bis(2-hydroxyethyl)-1-(methylamino)pentane-1-sulfonic acid |
| PubChem CID | 139775812 |
| Molecular Formula | C10H23NO6S |
| Molecular Weight | 285.36 g/mol |
| Exact Mass | 285.12 |
| IUPAC Name | 5-hydroxy-3,3-bis(2-hydroxyethyl)-1-(methylamino)pentane-1-sulfonic acid |
| SMILES | CNC(CC(CCO)(CCO)CCO)S(=O)(=O)O |
| InChI | InChI=1S/C10H23NO6S/c1-11-9(18(15,16)17)8-10(2-5-12,3-6-13)4-7-14/h9,11-14H,2-8H2,1H3,(H,15,16,17) |
| InChIKey | HLYMUTKXYXMHKX-UHFFFAOYSA-N |
| XLogP | -1.06 |
| TPSA | 127.09 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 285.36 |
| LogP ≤ 5 | -1.06 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze 5-hydroxy-3,3-bis(2-hydroxyethyl)-1-(methylamino)pentane-1-sulfonic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-hydroxy-3,3-bis(2-hydroxyethyl)-1-(methylamino)pentane-1-sulfonic acid?
The IUPAC name of 5-hydroxy-3,3-bis(2-hydroxyethyl)-1-(methylamino)pentane-1-sulfonic acid (CID 139775812) is 5-hydroxy-3,3-bis(2-hydroxyethyl)-1-(methylamino)pentane-1-sulfonic acid.
What is the SMILES notation for 5-hydroxy-3,3-bis(2-hydroxyethyl)-1-(methylamino)pentane-1-sulfonic acid?
The canonical SMILES for 5-hydroxy-3,3-bis(2-hydroxyethyl)-1-(methylamino)pentane-1-sulfonic acid is CNC(CC(CCO)(CCO)CCO)S(=O)(=O)O.
What is the InChIKey of 5-hydroxy-3,3-bis(2-hydroxyethyl)-1-(methylamino)pentane-1-sulfonic acid?
The InChIKey is HLYMUTKXYXMHKX-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H23NO6S/c1-11-9(18(15,16)17)8-10(2-5-12,3-6-13)4-7-14/h9,11-14H,2-8H2,1H3,(H,15,16,17).
What are the key properties of 5-hydroxy-3,3-bis(2-hydroxyethyl)-1-(methylamino)pentane-1-sulfonic acid?
5-hydroxy-3,3-bis(2-hydroxyethyl)-1-(methylamino)pentane-1-sulfonic acid has a molecular weight of 285.36 g/mol, XLogP of -1.06, 10 rotatable bonds, 5 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5-hydroxy-3,3-bis(2-hydroxyethyl)-1-(methylamino)pentane-1-sulfonic acid is sourced from PubChem (CID 139775812), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).