C13H7N3O7S — CID 139775951
2,4,5-trinitro-2,9-dihydrothioxanthen-1-one (PubChem CID 139775951) has the molecular formula C13H7N3O7S and a molecular weight of 349.28 g/mol. Its IUPAC name is 2,4,5-trinitro-2,9-dihydrothioxanthen-1-one.
| Compound Name | 2,4,5-trinitro-2,9-dihydrothioxanthen-1-one |
|---|---|
| PubChem CID | 139775951 |
| Molecular Formula | C13H7N3O7S |
| Molecular Weight | 349.28 g/mol |
| Exact Mass | 349.00 |
| IUPAC Name | 2,4,5-trinitro-2,9-dihydrothioxanthen-1-one |
| SMILES | O=C1C2=C(Sc3c(cccc3[N+](=O)[O-])C2)C([N+](=O)[O-])=CC1[N+](=O)[O-] |
| InChI | InChI=1S/C13H7N3O7S/c17-11-7-4-6-2-1-3-8(14(18)19)12(6)24-13(7)10(16(22)23)5-9(11)15(20)21/h1-3,5,9H,4H2 |
| InChIKey | NOGWZVPUHQQZET-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 146.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.28 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|