C19H17BrN2O2 — CID 1397764
[(4R)-4-(4-bromophenyl)-4,5-dihydro-1H-pyrazol-3-yl]-[(2R,3R)-2-methyl-3-phenyloxiran-2-yl]methanone (PubChem CID 1397764) has the molecular formula C19H17BrN2O2 and a molecular weight of 385.26 g/mol. Its IUPAC name is [(4R)-4-(4-bromophenyl)-4,5-dihydro-1H-pyrazol-3-yl]-[(2R,3R)-2-methyl-3-phenyloxiran-2-yl]methanone.
| Compound Name | [(4R)-4-(4-bromophenyl)-4,5-dihydro-1H-pyrazol-3-yl]-[(2R,3R)-2-methyl-3-phenyloxiran-2-yl]methanone |
|---|---|
| PubChem CID | 1397764 |
| Molecular Formula | C19H17BrN2O2 |
| Molecular Weight | 385.26 g/mol |
| Exact Mass | 384.05 |
| IUPAC Name | [(4R)-4-(4-bromophenyl)-4,5-dihydro-1H-pyrazol-3-yl]-[(2R,3R)-2-methyl-3-phenyloxiran-2-yl]methanone |
| SMILES | C[C@@]1(C(=O)C2=NNC[C@H]2c2ccc(Br)cc2)O[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C19H17BrN2O2/c1-19(18(24-19)13-5-3-2-4-6-13)17(23)16-15(11-21-22-16)12-7-9-14(20)10-8-12/h2-10,15,18,21H,11H2,1H3/t15-,18+,19-/m0/s1 |
| InChIKey | JYTSIWCJAPORSQ-IPELMVKDSA-N |
| XLogP | 3.59 |
| TPSA | 53.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.26 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|