About 4-prop-1-enoxy-1,3-dioxolan-2-one
4-prop-1-enoxy-1,3-dioxolan-2-one (PubChem CID 139776471) has the molecular formula C6H8O4
and a molecular weight of 144.13 g/mol. Its IUPAC name is 4-prop-1-enoxy-1,3-dioxolan-2-one.
Molecular Properties
| Compound Name | 4-prop-1-enoxy-1,3-dioxolan-2-one |
| PubChem CID | 139776471 |
| Molecular Formula | C6H8O4 |
| Molecular Weight | 144.13 g/mol |
| Exact Mass | 144.04 |
| IUPAC Name | 4-prop-1-enoxy-1,3-dioxolan-2-one |
| SMILES | CC=COC1COC(=O)O1 |
| InChI | InChI=1S/C6H8O4/c1-2-3-8-5-4-9-6(7)10-5/h2-3,5H,4H2,1H3 |
| InChIKey | MPMXQLXKVPNXRI-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 144.13 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|
Analyze 4-prop-1-enoxy-1,3-dioxolan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-prop-1-enoxy-1,3-dioxolan-2-one?
The IUPAC name of 4-prop-1-enoxy-1,3-dioxolan-2-one (CID 139776471) is 4-prop-1-enoxy-1,3-dioxolan-2-one.
What is the SMILES notation for 4-prop-1-enoxy-1,3-dioxolan-2-one?
The canonical SMILES for 4-prop-1-enoxy-1,3-dioxolan-2-one is CC=COC1COC(=O)O1.
What is the InChIKey of 4-prop-1-enoxy-1,3-dioxolan-2-one?
The InChIKey is MPMXQLXKVPNXRI-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8O4/c1-2-3-8-5-4-9-6(7)10-5/h2-3,5H,4H2,1H3.
What are the key properties of 4-prop-1-enoxy-1,3-dioxolan-2-one?
4-prop-1-enoxy-1,3-dioxolan-2-one has a molecular weight of 144.13 g/mol, XLogP of 1.03, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-prop-1-enoxy-1,3-dioxolan-2-one is sourced from PubChem (CID 139776471), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).