C15H18FN5O2 — CID 139776505
(1S,4S)-5-[4-[(2R)-2-(azidomethyl)-1,3-oxazolidin-3-yl]-2-fluorophenyl]-2-oxa-5-azabicyclo[2.2.1]heptane (PubChem CID 139776505) has the molecular formula C15H18FN5O2 and a molecular weight of 319.34 g/mol. Its IUPAC name is (1S,4S)-5-[4-[(2R)-2-(azidomethyl)-1,3-oxazolidin-3-yl]-2-fluorophenyl]-2-oxa-5-azabicyclo[2.2.1]heptane.
| Compound Name | (1S,4S)-5-[4-[(2R)-2-(azidomethyl)-1,3-oxazolidin-3-yl]-2-fluorophenyl]-2-oxa-5-azabicyclo[2.2.1]heptane |
|---|---|
| PubChem CID | 139776505 |
| Molecular Formula | C15H18FN5O2 |
| Molecular Weight | 319.34 g/mol |
| Exact Mass | 319.14 |
| IUPAC Name | (1S,4S)-5-[4-[(2R)-2-(azidomethyl)-1,3-oxazolidin-3-yl]-2-fluorophenyl]-2-oxa-5-azabicyclo[2.2.1]heptane |
| SMILES | [N-]=[N+]=NC[C@H]1OCCN1c1ccc(N2C[C@@H]3C[C@H]2CO3)c(F)c1 |
| InChI | InChI=1S/C15H18FN5O2/c16-13-6-10(20-3-4-22-15(20)7-18-19-17)1-2-14(13)21-8-12-5-11(21)9-23-12/h1-2,6,11-12,15H,3-5,7-9H2/t11-,12-,15+/m0/s1 |
| InChIKey | OVTHYYMXYFSUQB-SLEUVZQESA-N |
| XLogP | 2.28 |
| TPSA | 73.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.34 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|