About [(1S)-5-amino-1-carboxypentyl]azanium;2-hydroxypropanoate
[(1S)-5-amino-1-carboxypentyl]azanium;2-hydroxypropanoate (PubChem CID 139776614) has the molecular formula C9H20N2O5
and a molecular weight of 236.27 g/mol. Its IUPAC name is [(1S)-5-amino-1-carboxypentyl]azanium;2-hydroxypropanoate.
Molecular Properties
| Compound Name | [(1S)-5-amino-1-carboxypentyl]azanium;2-hydroxypropanoate |
| PubChem CID | 139776614 |
| Molecular Formula | C9H20N2O5 |
| Molecular Weight | 236.27 g/mol |
| Exact Mass | 236.14 |
| IUPAC Name | [(1S)-5-amino-1-carboxypentyl]azanium;2-hydroxypropanoate |
| SMILES | CC(O)C(=O)[O-].NCCCC[C@H]([NH3+])C(=O)O |
| InChI | InChI=1S/C6H14N2O2.C3H6O3/c7-4-2-1-3-5(8)6(9)10;1-2(4)3(5)6/h5H,1-4,7-8H2,(H,9,10);2,4H,1H3,(H,5,6)/t5-;/m0./s1 |
| InChIKey | GBRIDGNTDLIRMN-JEDNCBNOSA-N |
| XLogP | -3.07 |
| TPSA | 151.32 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 236.27 |
| LogP ≤ 5 | -3.07 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze [(1S)-5-amino-1-carboxypentyl]azanium;2-hydroxypropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(1S)-5-amino-1-carboxypentyl]azanium;2-hydroxypropanoate?
The IUPAC name of [(1S)-5-amino-1-carboxypentyl]azanium;2-hydroxypropanoate (CID 139776614) is [(1S)-5-amino-1-carboxypentyl]azanium;2-hydroxypropanoate.
What is the SMILES notation for [(1S)-5-amino-1-carboxypentyl]azanium;2-hydroxypropanoate?
The canonical SMILES for [(1S)-5-amino-1-carboxypentyl]azanium;2-hydroxypropanoate is CC(O)C(=O)[O-].NCCCC[C@H]([NH3+])C(=O)O.
What is the InChIKey of [(1S)-5-amino-1-carboxypentyl]azanium;2-hydroxypropanoate?
The InChIKey is GBRIDGNTDLIRMN-JEDNCBNOSA-N. The full InChI is InChI=1S/C6H14N2O2.C3H6O3/c7-4-2-1-3-5(8)6(9)10;1-2(4)3(5)6/h5H,1-4,7-8H2,(H,9,10);2,4H,1H3,(H,5,6)/t5-;/m0./s1.
What are the key properties of [(1S)-5-amino-1-carboxypentyl]azanium;2-hydroxypropanoate?
[(1S)-5-amino-1-carboxypentyl]azanium;2-hydroxypropanoate has a molecular weight of 236.27 g/mol, XLogP of -3.07, 6 rotatable bonds, 4 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [(1S)-5-amino-1-carboxypentyl]azanium;2-hydroxypropanoate is sourced from PubChem (CID 139776614), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).