About 2-[(2-hydroxy-3,3-dimethylbutanoyl)-methylamino]acetic acid
2-[(2-hydroxy-3,3-dimethylbutanoyl)-methylamino]acetic acid (PubChem CID 139777185) has the molecular formula C9H17NO4
and a molecular weight of 203.24 g/mol. Its IUPAC name is 2-[(2-hydroxy-3,3-dimethylbutanoyl)-methylamino]acetic acid.
Molecular Properties
| Compound Name | 2-[(2-hydroxy-3,3-dimethylbutanoyl)-methylamino]acetic acid |
| PubChem CID | 139777185 |
| Molecular Formula | C9H17NO4 |
| Molecular Weight | 203.24 g/mol |
| Exact Mass | 203.12 |
| IUPAC Name | 2-[(2-hydroxy-3,3-dimethylbutanoyl)-methylamino]acetic acid |
| SMILES | CN(CC(=O)O)C(=O)C(O)C(C)(C)C |
| InChI | InChI=1S/C9H17NO4/c1-9(2,3)7(13)8(14)10(4)5-6(11)12/h7,13H,5H2,1-4H3,(H,11,12) |
| InChIKey | XXRFYOMMVFDVEF-UHFFFAOYSA-N |
| XLogP | -0.06 |
| TPSA | 77.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 203.24 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-[(2-hydroxy-3,3-dimethylbutanoyl)-methylamino]acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(2-hydroxy-3,3-dimethylbutanoyl)-methylamino]acetic acid?
The IUPAC name of 2-[(2-hydroxy-3,3-dimethylbutanoyl)-methylamino]acetic acid (CID 139777185) is 2-[(2-hydroxy-3,3-dimethylbutanoyl)-methylamino]acetic acid.
What is the SMILES notation for 2-[(2-hydroxy-3,3-dimethylbutanoyl)-methylamino]acetic acid?
The canonical SMILES for 2-[(2-hydroxy-3,3-dimethylbutanoyl)-methylamino]acetic acid is CN(CC(=O)O)C(=O)C(O)C(C)(C)C.
What is the InChIKey of 2-[(2-hydroxy-3,3-dimethylbutanoyl)-methylamino]acetic acid?
The InChIKey is XXRFYOMMVFDVEF-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H17NO4/c1-9(2,3)7(13)8(14)10(4)5-6(11)12/h7,13H,5H2,1-4H3,(H,11,12).
What are the key properties of 2-[(2-hydroxy-3,3-dimethylbutanoyl)-methylamino]acetic acid?
2-[(2-hydroxy-3,3-dimethylbutanoyl)-methylamino]acetic acid has a molecular weight of 203.24 g/mol, XLogP of -0.06, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(2-hydroxy-3,3-dimethylbutanoyl)-methylamino]acetic acid is sourced from PubChem (CID 139777185), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).