C18H7F5 — CID 139777268
2,5,6,11,12-pentafluorotetracene (PubChem CID 139777268) has the molecular formula C18H7F5 and a molecular weight of 318.24 g/mol. Its IUPAC name is 2,5,6,11,12-pentafluorotetracene.
| Compound Name | 2,5,6,11,12-pentafluorotetracene |
|---|---|
| PubChem CID | 139777268 |
| Molecular Formula | C18H7F5 |
| Molecular Weight | 318.24 g/mol |
| Exact Mass | 318.05 |
| IUPAC Name | 2,5,6,11,12-pentafluorotetracene |
| SMILES | Fc1ccc2c(F)c3c(F)c4ccccc4c(F)c3c(F)c2c1 |
| InChI | InChI=1S/C18H7F5/c19-8-5-6-11-12(7-8)18(23)14-13(17(11)22)15(20)9-3-1-2-4-10(9)16(14)21/h1-7H |
| InChIKey | LTFWKNHFQGDYDE-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.24 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|