About diazanium;4-amino-3,5,6-trifluorophthalate
diazanium;4-amino-3,5,6-trifluorophthalate (PubChem CID 139777270) has the molecular formula C8H10F3N3O4
and a molecular weight of 269.18 g/mol. Its IUPAC name is diazanium;4-amino-3,5,6-trifluorophthalate.
Molecular Properties
| Compound Name | diazanium;4-amino-3,5,6-trifluorophthalate |
| PubChem CID | 139777270 |
| Molecular Formula | C8H10F3N3O4 |
| Molecular Weight | 269.18 g/mol |
| Exact Mass | 269.06 |
| IUPAC Name | diazanium;4-amino-3,5,6-trifluorophthalate |
| SMILES | Nc1c(F)c(F)c(C(=O)[O-])c(C(=O)[O-])c1F.[NH4+].[NH4+] |
| InChI | InChI=1S/C8H4F3NO4.2H3N/c9-3-1(7(13)14)2(8(15)16)4(10)6(12)5(3)11;;/h12H2,(H,13,14)(H,15,16);2*1H3 |
| InChIKey | AMWVBPRTEGYHHY-UHFFFAOYSA-N |
| XLogP | -0.83 |
| TPSA | 179.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 269.18 |
| LogP ≤ 5 | -0.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|
Analyze diazanium;4-amino-3,5,6-trifluorophthalate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of diazanium;4-amino-3,5,6-trifluorophthalate?
The IUPAC name of diazanium;4-amino-3,5,6-trifluorophthalate (CID 139777270) is diazanium;4-amino-3,5,6-trifluorophthalate.
What is the SMILES notation for diazanium;4-amino-3,5,6-trifluorophthalate?
The canonical SMILES for diazanium;4-amino-3,5,6-trifluorophthalate is Nc1c(F)c(F)c(C(=O)[O-])c(C(=O)[O-])c1F.[NH4+].[NH4+].
What is the InChIKey of diazanium;4-amino-3,5,6-trifluorophthalate?
The InChIKey is AMWVBPRTEGYHHY-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H4F3NO4.2H3N/c9-3-1(7(13)14)2(8(15)16)4(10)6(12)5(3)11;;/h12H2,(H,13,14)(H,15,16);2*1H3.
What are the key properties of diazanium;4-amino-3,5,6-trifluorophthalate?
diazanium;4-amino-3,5,6-trifluorophthalate has a molecular weight of 269.18 g/mol, XLogP of -0.83, 2 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for diazanium;4-amino-3,5,6-trifluorophthalate is sourced from PubChem (CID 139777270), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).