C12H19NO6 — CID 139777494
(2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-(2-methylprop-2-enoyloxy)propanoic acid (PubChem CID 139777494) has the molecular formula C12H19NO6 and a molecular weight of 273.29 g/mol. Its IUPAC name is (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-(2-methylprop-2-enoyloxy)propanoic acid.
| Compound Name | (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-(2-methylprop-2-enoyloxy)propanoic acid |
|---|---|
| PubChem CID | 139777494 |
| Molecular Formula | C12H19NO6 |
| Molecular Weight | 273.29 g/mol |
| Exact Mass | 273.12 |
| IUPAC Name | (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-(2-methylprop-2-enoyloxy)propanoic acid |
| SMILES | C=C(C)C(=O)OC[C@H](NC(=O)OC(C)(C)C)C(=O)O |
| InChI | InChI=1S/C12H19NO6/c1-7(2)10(16)18-6-8(9(14)15)13-11(17)19-12(3,4)5/h8H,1,6H2,2-5H3,(H,13,17)(H,14,15)/t8-/m0/s1 |
| InChIKey | ZWUSVJYGQGNXOE-QMMMGPOBSA-N |
| XLogP | 1.08 |
| TPSA | 101.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.29 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|