C16H18NO3+ — CID 139777906
(2,3-dimethylphenyl) 1-ethoxypyridin-1-ium-2-carboxylate (PubChem CID 139777906) has the molecular formula C16H18NO3+ and a molecular weight of 272.32 g/mol. Its IUPAC name is (2,3-dimethylphenyl) 1-ethoxypyridin-1-ium-2-carboxylate.
| Compound Name | (2,3-dimethylphenyl) 1-ethoxypyridin-1-ium-2-carboxylate |
|---|---|
| PubChem CID | 139777906 |
| Molecular Formula | C16H18NO3+ |
| Molecular Weight | 272.32 g/mol |
| Exact Mass | 272.13 |
| IUPAC Name | (2,3-dimethylphenyl) 1-ethoxypyridin-1-ium-2-carboxylate |
| SMILES | CCO[n+]1ccccc1C(=O)Oc1cccc(C)c1C |
| InChI | InChI=1S/C16H18NO3/c1-4-19-17-11-6-5-9-14(17)16(18)20-15-10-7-8-12(2)13(15)3/h5-11H,4H2,1-3H3/q+1 |
| InChIKey | KJFZZAXTCBIFAI-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 39.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.32 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|