C42H43BN4O9 — CID 139778079
bis(cyanomethyl 1-ethoxypyridin-1-ium-2-carboxylate);dioxido(4,4,4-triphenylbutoxy)borane (PubChem CID 139778079) has the molecular formula C42H43BN4O9 and a molecular weight of 758.64 g/mol. Its IUPAC name is bis(cyanomethyl 1-ethoxypyridin-1-ium-2-carboxylate);dioxido(4,4,4-triphenylbutoxy)borane.
| Compound Name | bis(cyanomethyl 1-ethoxypyridin-1-ium-2-carboxylate);dioxido(4,4,4-triphenylbutoxy)borane |
|---|---|
| PubChem CID | 139778079 |
| Molecular Formula | C42H43BN4O9 |
| Molecular Weight | 758.64 g/mol |
| Exact Mass | 758.31 |
| IUPAC Name | bis(cyanomethyl 1-ethoxypyridin-1-ium-2-carboxylate);dioxido(4,4,4-triphenylbutoxy)borane |
| SMILES | CCO[n+]1ccccc1C(=O)OCC#N.CCO[n+]1ccccc1C(=O)OCC#N.[O-]B([O-])OCCCC(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C22H21BO3.2C10H11N2O3/c24-23(25)26-18-10-17-22(19-11-4-1-5-12-19,20-13-6-2-7-14-20)21-15-8-3-9-16-21;2*1-2-15-12-7-4-3-5-9(12)10(13)14-8-6-11/h1-9,11-16H,10,17-18H2;2*3-5,7H,2,8H2,1H3/q-2;2*+1 |
| InChIKey | JKLJMYLIWUZIGV-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 181.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 758.64 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|