C46H57BN2O9 — CID 139778109
bis(butyl 1-ethoxypyridin-1-ium-2-carboxylate);dioxido(4,4,4-triphenylbutoxy)borane (PubChem CID 139778109) has the molecular formula C46H57BN2O9 and a molecular weight of 792.78 g/mol. Its IUPAC name is bis(butyl 1-ethoxypyridin-1-ium-2-carboxylate);dioxido(4,4,4-triphenylbutoxy)borane.
| Compound Name | bis(butyl 1-ethoxypyridin-1-ium-2-carboxylate);dioxido(4,4,4-triphenylbutoxy)borane |
|---|---|
| PubChem CID | 139778109 |
| Molecular Formula | C46H57BN2O9 |
| Molecular Weight | 792.78 g/mol |
| Exact Mass | 792.42 |
| IUPAC Name | bis(butyl 1-ethoxypyridin-1-ium-2-carboxylate);dioxido(4,4,4-triphenylbutoxy)borane |
| SMILES | CCCCOC(=O)c1cccc[n+]1OCC.CCCCOC(=O)c1cccc[n+]1OCC.[O-]B([O-])OCCCC(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C22H21BO3.2C12H18NO3/c24-23(25)26-18-10-17-22(19-11-4-1-5-12-19,20-13-6-2-7-14-20)21-15-8-3-9-16-21;2*1-3-5-10-15-12(14)11-8-6-7-9-13(11)16-4-2/h1-9,11-16H,10,17-18H2;2*6-9H,3-5,10H2,1-2H3/q-2;2*+1 |
| InChIKey | IJORUVBUFFLIDL-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 134.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 792.78 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|