About dioxido(4,4,4-triphenylbutoxy)borane;bis(1-phenoxypyridin-1-ium)
dioxido(4,4,4-triphenylbutoxy)borane;bis(1-phenoxypyridin-1-ium) (PubChem CID 139778143) has the molecular formula C44H41BN2O5
and a molecular weight of 688.63 g/mol. Its IUPAC name is dioxido(4,4,4-triphenylbutoxy)borane;bis(1-phenoxypyridin-1-ium).
Molecular Properties
| Compound Name | dioxido(4,4,4-triphenylbutoxy)borane;bis(1-phenoxypyridin-1-ium) |
| PubChem CID | 139778143 |
| Molecular Formula | C44H41BN2O5 |
| Molecular Weight | 688.63 g/mol |
| Exact Mass | 688.31 |
| IUPAC Name | dioxido(4,4,4-triphenylbutoxy)borane;bis(1-phenoxypyridin-1-ium) |
| SMILES | [O-]B([O-])OCCCC(c1ccccc1)(c1ccccc1)c1ccccc1.c1ccc(O[n+]2ccccc2)cc1.c1ccc(O[n+]2ccccc2)cc1 |
| InChI | InChI=1S/C22H21BO3.2C11H10NO/c24-23(25)26-18-10-17-22(19-11-4-1-5-12-19,20-13-6-2-7-14-20)21-15-8-3-9-16-21;2*1-3-7-11(8-4-1)13-12-9-5-2-6-10-12/h1-9,11-16H,10,17-18H2;2*1-10H/q-2;2*+1 |
| InChIKey | RVYNPSPZPUNXNS-UHFFFAOYSA-N |
| XLogP | 6.16 |
| TPSA | 81.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 52 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 688.63 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|
Analyze dioxido(4,4,4-triphenylbutoxy)borane;bis(1-phenoxypyridin-1-ium) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dioxido(4,4,4-triphenylbutoxy)borane;bis(1-phenoxypyridin-1-ium)?
The IUPAC name of dioxido(4,4,4-triphenylbutoxy)borane;bis(1-phenoxypyridin-1-ium) (CID 139778143) is dioxido(4,4,4-triphenylbutoxy)borane;bis(1-phenoxypyridin-1-ium).
What is the SMILES notation for dioxido(4,4,4-triphenylbutoxy)borane;bis(1-phenoxypyridin-1-ium)?
The canonical SMILES for dioxido(4,4,4-triphenylbutoxy)borane;bis(1-phenoxypyridin-1-ium) is [O-]B([O-])OCCCC(c1ccccc1)(c1ccccc1)c1ccccc1.c1ccc(O[n+]2ccccc2)cc1.c1ccc(O[n+]2ccccc2)cc1.
What is the InChIKey of dioxido(4,4,4-triphenylbutoxy)borane;bis(1-phenoxypyridin-1-ium)?
The InChIKey is RVYNPSPZPUNXNS-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H21BO3.2C11H10NO/c24-23(25)26-18-10-17-22(19-11-4-1-5-12-19,20-13-6-2-7-14-20)21-15-8-3-9-16-21;2*1-3-7-11(8-4-1)13-12-9-5-2-6-10-12/h1-9,11-16H,10,17-18H2;2*1-10H/q-2;2*+1.
What are the key properties of dioxido(4,4,4-triphenylbutoxy)borane;bis(1-phenoxypyridin-1-ium)?
dioxido(4,4,4-triphenylbutoxy)borane;bis(1-phenoxypyridin-1-ium) has a molecular weight of 688.63 g/mol, XLogP of 6.16, 12 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for dioxido(4,4,4-triphenylbutoxy)borane;bis(1-phenoxypyridin-1-ium) is sourced from PubChem (CID 139778143), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).