C44H53BN2O9 — CID 139778319
dioxido(4,4,4-triphenylbutoxy)borane;bis(propan-2-yl 1-ethoxypyridin-1-ium-2-carboxylate) (PubChem CID 139778319) has the molecular formula C44H53BN2O9 and a molecular weight of 764.72 g/mol. Its IUPAC name is dioxido(4,4,4-triphenylbutoxy)borane;bis(propan-2-yl 1-ethoxypyridin-1-ium-2-carboxylate).
| Compound Name | dioxido(4,4,4-triphenylbutoxy)borane;bis(propan-2-yl 1-ethoxypyridin-1-ium-2-carboxylate) |
|---|---|
| PubChem CID | 139778319 |
| Molecular Formula | C44H53BN2O9 |
| Molecular Weight | 764.72 g/mol |
| Exact Mass | 764.38 |
| IUPAC Name | dioxido(4,4,4-triphenylbutoxy)borane;bis(propan-2-yl 1-ethoxypyridin-1-ium-2-carboxylate) |
| SMILES | CCO[n+]1ccccc1C(=O)OC(C)C.CCO[n+]1ccccc1C(=O)OC(C)C.[O-]B([O-])OCCCC(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C22H21BO3.2C11H16NO3/c24-23(25)26-18-10-17-22(19-11-4-1-5-12-19,20-13-6-2-7-14-20)21-15-8-3-9-16-21;2*1-4-14-12-8-6-5-7-10(12)11(13)15-9(2)3/h1-9,11-16H,10,17-18H2;2*5-9H,4H2,1-3H3/q-2;2*+1 |
| InChIKey | CUTJMKRHBNFRDO-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 134.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 56 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 764.72 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|