C23H30F2N2O — CID 139778925
3-(4-butoxy-2,3-difluorophenyl)-6-[2-(4-methylcyclohexyl)ethyl]pyridazine (PubChem CID 139778925) has the molecular formula C23H30F2N2O and a molecular weight of 388.50 g/mol. Its IUPAC name is 3-(4-butoxy-2,3-difluorophenyl)-6-[2-(4-methylcyclohexyl)ethyl]pyridazine.
| Compound Name | 3-(4-butoxy-2,3-difluorophenyl)-6-[2-(4-methylcyclohexyl)ethyl]pyridazine |
|---|---|
| PubChem CID | 139778925 |
| Molecular Formula | C23H30F2N2O |
| Molecular Weight | 388.50 g/mol |
| Exact Mass | 388.23 |
| IUPAC Name | 3-(4-butoxy-2,3-difluorophenyl)-6-[2-(4-methylcyclohexyl)ethyl]pyridazine |
| SMILES | CCCCOc1ccc(-c2ccc(CCC3CCC(C)CC3)nn2)c(F)c1F |
| InChI | InChI=1S/C23H30F2N2O/c1-3-4-15-28-21-14-12-19(22(24)23(21)25)20-13-11-18(26-27-20)10-9-17-7-5-16(2)6-8-17/h11-14,16-17H,3-10,15H2,1-2H3 |
| InChIKey | WQMUOJYMLRERBS-UHFFFAOYSA-N |
| XLogP | 6.36 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.50 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|