About (3,3-dimethyl-2-oxo-1-benzofuran-5-yl) 2-phenylethanesulfonate
(3,3-dimethyl-2-oxo-1-benzofuran-5-yl) 2-phenylethanesulfonate (PubChem CID 139779324) has the molecular formula C18H18O5S
and a molecular weight of 346.40 g/mol. Its IUPAC name is (3,3-dimethyl-2-oxo-1-benzofuran-5-yl) 2-phenylethanesulfonate.
Molecular Properties
| Compound Name | (3,3-dimethyl-2-oxo-1-benzofuran-5-yl) 2-phenylethanesulfonate |
| PubChem CID | 139779324 |
| Molecular Formula | C18H18O5S |
| Molecular Weight | 346.40 g/mol |
| Exact Mass | 346.09 |
| IUPAC Name | (3,3-dimethyl-2-oxo-1-benzofuran-5-yl) 2-phenylethanesulfonate |
| SMILES | CC1(C)C(=O)Oc2ccc(OS(=O)(=O)CCc3ccccc3)cc21 |
| InChI | InChI=1S/C18H18O5S/c1-18(2)15-12-14(8-9-16(15)22-17(18)19)23-24(20,21)11-10-13-6-4-3-5-7-13/h3-9,12H,10-11H2,1-2H3 |
| InChIKey | MKFLJNVUZQJEMR-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 346.40 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze (3,3-dimethyl-2-oxo-1-benzofuran-5-yl) 2-phenylethanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3,3-dimethyl-2-oxo-1-benzofuran-5-yl) 2-phenylethanesulfonate?
The IUPAC name of (3,3-dimethyl-2-oxo-1-benzofuran-5-yl) 2-phenylethanesulfonate (CID 139779324) is (3,3-dimethyl-2-oxo-1-benzofuran-5-yl) 2-phenylethanesulfonate.
What is the SMILES notation for (3,3-dimethyl-2-oxo-1-benzofuran-5-yl) 2-phenylethanesulfonate?
The canonical SMILES for (3,3-dimethyl-2-oxo-1-benzofuran-5-yl) 2-phenylethanesulfonate is CC1(C)C(=O)Oc2ccc(OS(=O)(=O)CCc3ccccc3)cc21.
What is the InChIKey of (3,3-dimethyl-2-oxo-1-benzofuran-5-yl) 2-phenylethanesulfonate?
The InChIKey is MKFLJNVUZQJEMR-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H18O5S/c1-18(2)15-12-14(8-9-16(15)22-17(18)19)23-24(20,21)11-10-13-6-4-3-5-7-13/h3-9,12H,10-11H2,1-2H3.
What are the key properties of (3,3-dimethyl-2-oxo-1-benzofuran-5-yl) 2-phenylethanesulfonate?
(3,3-dimethyl-2-oxo-1-benzofuran-5-yl) 2-phenylethanesulfonate has a molecular weight of 346.40 g/mol, XLogP of 2.83, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (3,3-dimethyl-2-oxo-1-benzofuran-5-yl) 2-phenylethanesulfonate is sourced from PubChem (CID 139779324), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).