C36H39N3O6 — CID 139779861
2,4,6-tris[2-methoxy-6-(2-methylprop-2-enyl)phenoxy]-1,3,5-triazine (PubChem CID 139779861) has the molecular formula C36H39N3O6 and a molecular weight of 609.72 g/mol. Its IUPAC name is 2,4,6-tris[2-methoxy-6-(2-methylprop-2-enyl)phenoxy]-1,3,5-triazine.
| Compound Name | 2,4,6-tris[2-methoxy-6-(2-methylprop-2-enyl)phenoxy]-1,3,5-triazine |
|---|---|
| PubChem CID | 139779861 |
| Molecular Formula | C36H39N3O6 |
| Molecular Weight | 609.72 g/mol |
| Exact Mass | 609.28 |
| IUPAC Name | 2,4,6-tris[2-methoxy-6-(2-methylprop-2-enyl)phenoxy]-1,3,5-triazine |
| SMILES | C=C(C)Cc1cccc(OC)c1Oc1nc(Oc2c(CC(=C)C)cccc2OC)nc(Oc2c(CC(=C)C)cccc2OC)n1 |
| InChI | InChI=1S/C36H39N3O6/c1-22(2)19-25-13-10-16-28(40-7)31(25)43-34-37-35(44-32-26(20-23(3)4)14-11-17-29(32)41-8)39-36(38-34)45-33-27(21-24(5)6)15-12-18-30(33)42-9/h10-18H,1,3,5,19-21H2,2,4,6-9H3 |
| InChIKey | AINZBXVCXNELQM-UHFFFAOYSA-N |
| XLogP | 8.63 |
| TPSA | 94.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.72 |
| LogP ≤ 5 | 8.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|