C31H31N3O5 — CID 139779883
2,4-bis[4-methoxy-2-(2-methylprop-2-enyl)phenoxy]-6-phenoxy-1,3,5-triazine (PubChem CID 139779883) has the molecular formula C31H31N3O5 and a molecular weight of 525.61 g/mol. Its IUPAC name is 2,4-bis[4-methoxy-2-(2-methylprop-2-enyl)phenoxy]-6-phenoxy-1,3,5-triazine.
| Compound Name | 2,4-bis[4-methoxy-2-(2-methylprop-2-enyl)phenoxy]-6-phenoxy-1,3,5-triazine |
|---|---|
| PubChem CID | 139779883 |
| Molecular Formula | C31H31N3O5 |
| Molecular Weight | 525.61 g/mol |
| Exact Mass | 525.23 |
| IUPAC Name | 2,4-bis[4-methoxy-2-(2-methylprop-2-enyl)phenoxy]-6-phenoxy-1,3,5-triazine |
| SMILES | C=C(C)Cc1cc(OC)ccc1Oc1nc(Oc2ccccc2)nc(Oc2ccc(OC)cc2CC(=C)C)n1 |
| InChI | InChI=1S/C31H31N3O5/c1-20(2)16-22-18-25(35-5)12-14-27(22)38-30-32-29(37-24-10-8-7-9-11-24)33-31(34-30)39-28-15-13-26(36-6)19-23(28)17-21(3)4/h7-15,18-19H,1,3,16-17H2,2,4-6H3 |
| InChIKey | PPIXXWYWRBSUAI-UHFFFAOYSA-N |
| XLogP | 7.50 |
| TPSA | 84.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.61 |
| LogP ≤ 5 | 7.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|