C7H9NO5 — CID 139781494
methyl 2-(2,5-dioxopyrrolidin-1-yl)-2-hydroxyacetate (PubChem CID 139781494) has the molecular formula C7H9NO5 and a molecular weight of 187.15 g/mol. Its IUPAC name is methyl 2-(2,5-dioxopyrrolidin-1-yl)-2-hydroxyacetate.
| Compound Name | methyl 2-(2,5-dioxopyrrolidin-1-yl)-2-hydroxyacetate |
|---|---|
| PubChem CID | 139781494 |
| Molecular Formula | C7H9NO5 |
| Molecular Weight | 187.15 g/mol |
| Exact Mass | 187.05 |
| IUPAC Name | methyl 2-(2,5-dioxopyrrolidin-1-yl)-2-hydroxyacetate |
| SMILES | COC(=O)C(O)N1C(=O)CCC1=O |
| InChI | InChI=1S/C7H9NO5/c1-13-7(12)6(11)8-4(9)2-3-5(8)10/h6,11H,2-3H2,1H3 |
| InChIKey | SZSRUXCCVGROIM-UHFFFAOYSA-N |
| XLogP | -1.37 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.15 |
| LogP ≤ 5 | -1.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|