About 4-ethyl-4-morpholin-4-yl-1,3,2-dioxathietane 2,2-dioxide
4-ethyl-4-morpholin-4-yl-1,3,2-dioxathietane 2,2-dioxide (PubChem CID 139781712) has the molecular formula C7H13NO5S
and a molecular weight of 223.25 g/mol. Its IUPAC name is 4-ethyl-4-morpholin-4-yl-1,3,2-dioxathietane 2,2-dioxide.
Analyze 4-ethyl-4-morpholin-4-yl-1,3,2-dioxathietane 2,2-dioxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-ethyl-4-morpholin-4-yl-1,3,2-dioxathietane 2,2-dioxide?
The IUPAC name of 4-ethyl-4-morpholin-4-yl-1,3,2-dioxathietane 2,2-dioxide (CID 139781712) is 4-ethyl-4-morpholin-4-yl-1,3,2-dioxathietane 2,2-dioxide.
What is the SMILES notation for 4-ethyl-4-morpholin-4-yl-1,3,2-dioxathietane 2,2-dioxide?
The canonical SMILES for 4-ethyl-4-morpholin-4-yl-1,3,2-dioxathietane 2,2-dioxide is CCC1(N2CCOCC2)OS(=O)(=O)O1.
What is the InChIKey of 4-ethyl-4-morpholin-4-yl-1,3,2-dioxathietane 2,2-dioxide?
The InChIKey is VFYMXJNPTQRVLY-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H13NO5S/c1-2-7(12-14(9,10)13-7)8-3-5-11-6-4-8/h2-6H2,1H3.
What are the key properties of 4-ethyl-4-morpholin-4-yl-1,3,2-dioxathietane 2,2-dioxide?
4-ethyl-4-morpholin-4-yl-1,3,2-dioxathietane 2,2-dioxide has a molecular weight of 223.25 g/mol, XLogP of -0.33, 2 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-ethyl-4-morpholin-4-yl-1,3,2-dioxathietane 2,2-dioxide is sourced from PubChem (CID 139781712), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).