C28H24N2O2 — CID 139781792
3,8-dimethyl-2,7-bis(4-methylphenyl)-1,6-dihydropyrido[2,3-g]quinoline-4,9-dione (PubChem CID 139781792) has the molecular formula C28H24N2O2 and a molecular weight of 420.51 g/mol. Its IUPAC name is 3,8-dimethyl-2,7-bis(4-methylphenyl)-1,6-dihydropyrido[2,3-g]quinoline-4,9-dione.
| Compound Name | 3,8-dimethyl-2,7-bis(4-methylphenyl)-1,6-dihydropyrido[2,3-g]quinoline-4,9-dione |
|---|---|
| PubChem CID | 139781792 |
| Molecular Formula | C28H24N2O2 |
| Molecular Weight | 420.51 g/mol |
| Exact Mass | 420.18 |
| IUPAC Name | 3,8-dimethyl-2,7-bis(4-methylphenyl)-1,6-dihydropyrido[2,3-g]quinoline-4,9-dione |
| SMILES | Cc1ccc(-c2[nH]c3cc4c(=O)c(C)c(-c5ccc(C)cc5)[nH]c4cc3c(=O)c2C)cc1 |
| InChI | InChI=1S/C28H24N2O2/c1-15-5-9-19(10-6-15)25-17(3)27(31)21-14-24-22(13-23(21)29-25)28(32)18(4)26(30-24)20-11-7-16(2)8-12-20/h5-14H,1-4H3,(H,29,31)(H,30,32) |
| InChIKey | HBORYPOBQMPCKV-UHFFFAOYSA-N |
| XLogP | 5.94 |
| TPSA | 65.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.51 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|