C30H24N2O4 — CID 139781794
2,7-bis(2-propanoylphenyl)-1,6-dihydropyrido[2,3-g]quinoline-4,9-dione (PubChem CID 139781794) has the molecular formula C30H24N2O4 and a molecular weight of 476.53 g/mol. Its IUPAC name is 2,7-bis(2-propanoylphenyl)-1,6-dihydropyrido[2,3-g]quinoline-4,9-dione.
| Compound Name | 2,7-bis(2-propanoylphenyl)-1,6-dihydropyrido[2,3-g]quinoline-4,9-dione |
|---|---|
| PubChem CID | 139781794 |
| Molecular Formula | C30H24N2O4 |
| Molecular Weight | 476.53 g/mol |
| Exact Mass | 476.17 |
| IUPAC Name | 2,7-bis(2-propanoylphenyl)-1,6-dihydropyrido[2,3-g]quinoline-4,9-dione |
| SMILES | CCC(=O)c1ccccc1-c1cc(=O)c2cc3[nH]c(-c4ccccc4C(=O)CC)cc(=O)c3cc2[nH]1 |
| InChI | InChI=1S/C30H24N2O4/c1-3-27(33)19-11-7-5-9-17(19)25-15-29(35)21-14-24-22(13-23(21)31-25)30(36)16-26(32-24)18-10-6-8-12-20(18)28(34)4-2/h5-16H,3-4H2,1-2H3,(H,31,35)(H,32,36) |
| InChIKey | QWKOREBLFQZTFE-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 99.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.53 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|