C26H20N2O2 — CID 139781798
2,7-bis(2-methylphenyl)-1,6-dihydropyrido[2,3-g]quinoline-4,9-dione (PubChem CID 139781798) has the molecular formula C26H20N2O2 and a molecular weight of 392.46 g/mol. Its IUPAC name is 2,7-bis(2-methylphenyl)-1,6-dihydropyrido[2,3-g]quinoline-4,9-dione.
| Compound Name | 2,7-bis(2-methylphenyl)-1,6-dihydropyrido[2,3-g]quinoline-4,9-dione |
|---|---|
| PubChem CID | 139781798 |
| Molecular Formula | C26H20N2O2 |
| Molecular Weight | 392.46 g/mol |
| Exact Mass | 392.15 |
| IUPAC Name | 2,7-bis(2-methylphenyl)-1,6-dihydropyrido[2,3-g]quinoline-4,9-dione |
| SMILES | Cc1ccccc1-c1cc(=O)c2cc3[nH]c(-c4ccccc4C)cc(=O)c3cc2[nH]1 |
| InChI | InChI=1S/C26H20N2O2/c1-15-7-3-5-9-17(15)23-13-25(29)19-12-22-20(11-21(19)27-23)26(30)14-24(28-22)18-10-6-4-8-16(18)2/h3-14H,1-2H3,(H,27,29)(H,28,30) |
| InChIKey | WCOOGUMHGXLQHM-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 65.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.46 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|