C23H42OS — CID 139782082
1,2-ditert-butyl-4-(octylsulfanylmethyl)cyclohexa-2,4-dien-1-ol (PubChem CID 139782082) has the molecular formula C23H42OS and a molecular weight of 366.66 g/mol. Its IUPAC name is 1,2-ditert-butyl-4-(octylsulfanylmethyl)cyclohexa-2,4-dien-1-ol.
| Compound Name | 1,2-ditert-butyl-4-(octylsulfanylmethyl)cyclohexa-2,4-dien-1-ol |
|---|---|
| PubChem CID | 139782082 |
| Molecular Formula | C23H42OS |
| Molecular Weight | 366.66 g/mol |
| Exact Mass | 366.30 |
| IUPAC Name | 1,2-ditert-butyl-4-(octylsulfanylmethyl)cyclohexa-2,4-dien-1-ol |
| SMILES | CCCCCCCCSCC1=CCC(O)(C(C)(C)C)C(C(C)(C)C)=C1 |
| InChI | InChI=1S/C23H42OS/c1-8-9-10-11-12-13-16-25-18-19-14-15-23(24,22(5,6)7)20(17-19)21(2,3)4/h14,17,24H,8-13,15-16,18H2,1-7H3 |
| InChIKey | FBBXJOPIWZJLPG-UHFFFAOYSA-N |
| XLogP | 7.16 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.66 |
| LogP ≤ 5 | 7.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|