C16H26O3 — CID 139783783
4-[[3-(3-hydroxypropyl)phenoxy]methyl]hexan-1-ol (PubChem CID 139783783) has the molecular formula C16H26O3 and a molecular weight of 266.38 g/mol. Its IUPAC name is 4-[[3-(3-hydroxypropyl)phenoxy]methyl]hexan-1-ol.
| Compound Name | 4-[[3-(3-hydroxypropyl)phenoxy]methyl]hexan-1-ol |
|---|---|
| PubChem CID | 139783783 |
| Molecular Formula | C16H26O3 |
| Molecular Weight | 266.38 g/mol |
| Exact Mass | 266.19 |
| IUPAC Name | 4-[[3-(3-hydroxypropyl)phenoxy]methyl]hexan-1-ol |
| SMILES | CCC(CCCO)COc1cccc(CCCO)c1 |
| InChI | InChI=1S/C16H26O3/c1-2-14(7-4-10-17)13-19-16-9-3-6-15(12-16)8-5-11-18/h3,6,9,12,14,17-18H,2,4-5,7-8,10-11,13H2,1H3 |
| InChIKey | GNUORFRHAPCVHB-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.38 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |