C36H32N2O6 — CID 139783909
dimethyl 3,4-bis[[4-(pyridin-3-ylmethyl)phenyl]methoxy]benzene-1,2-dicarboxylate (PubChem CID 139783909) has the molecular formula C36H32N2O6 and a molecular weight of 588.66 g/mol. Its IUPAC name is dimethyl 3,4-bis[[4-(pyridin-3-ylmethyl)phenyl]methoxy]benzene-1,2-dicarboxylate.
| Compound Name | dimethyl 3,4-bis[[4-(pyridin-3-ylmethyl)phenyl]methoxy]benzene-1,2-dicarboxylate |
|---|---|
| PubChem CID | 139783909 |
| Molecular Formula | C36H32N2O6 |
| Molecular Weight | 588.66 g/mol |
| Exact Mass | 588.23 |
| IUPAC Name | dimethyl 3,4-bis[[4-(pyridin-3-ylmethyl)phenyl]methoxy]benzene-1,2-dicarboxylate |
| SMILES | COC(=O)c1ccc(OCc2ccc(Cc3cccnc3)cc2)c(OCc2ccc(Cc3cccnc3)cc2)c1C(=O)OC |
| InChI | InChI=1S/C36H32N2O6/c1-41-35(39)31-15-16-32(43-23-27-11-7-25(8-12-27)19-29-5-3-17-37-21-29)34(33(31)36(40)42-2)44-24-28-13-9-26(10-14-28)20-30-6-4-18-38-22-30/h3-18,21-22H,19-20,23-24H2,1-2H3 |
| InChIKey | GTVDBPGGVWCTJH-UHFFFAOYSA-N |
| XLogP | 6.39 |
| TPSA | 96.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.66 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |