C26H42OSi — CID 139784554
(2-butylcyclopenta-1,3-dien-1-yl)-(3,5-ditert-butyl-2-methoxyphenyl)-dimethylsilane (PubChem CID 139784554) has the molecular formula C26H42OSi and a molecular weight of 398.71 g/mol. Its IUPAC name is (2-butylcyclopenta-1,3-dien-1-yl)-(3,5-ditert-butyl-2-methoxyphenyl)-dimethylsilane.
| Compound Name | (2-butylcyclopenta-1,3-dien-1-yl)-(3,5-ditert-butyl-2-methoxyphenyl)-dimethylsilane |
|---|---|
| PubChem CID | 139784554 |
| Molecular Formula | C26H42OSi |
| Molecular Weight | 398.71 g/mol |
| Exact Mass | 398.30 |
| IUPAC Name | (2-butylcyclopenta-1,3-dien-1-yl)-(3,5-ditert-butyl-2-methoxyphenyl)-dimethylsilane |
| SMILES | CCCCC1=C([Si](C)(C)c2cc(C(C)(C)C)cc(C(C)(C)C)c2OC)CC=C1 |
| InChI | InChI=1S/C26H42OSi/c1-11-12-14-19-15-13-16-22(19)28(9,10)23-18-20(25(2,3)4)17-21(24(23)27-8)26(5,6)7/h13,15,17-18H,11-12,14,16H2,1-10H3 |
| InChIKey | RDBHBIUCBXDFES-UHFFFAOYSA-N |
| XLogP | 7.19 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.71 |
| LogP ≤ 5 | 7.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|