About (3-tert-butyl-5-chloro-2-methoxyphenyl)-(1,2-dimethylcyclopenta-2,4-dien-1-yl)-dimethylsilane
(3-tert-butyl-5-chloro-2-methoxyphenyl)-(1,2-dimethylcyclopenta-2,4-dien-1-yl)-dimethylsilane (PubChem CID 139784661) has the molecular formula C20H29ClOSi
and a molecular weight of 348.99 g/mol. Its IUPAC name is (3-tert-butyl-5-chloro-2-methoxyphenyl)-(1,2-dimethylcyclopenta-2,4-dien-1-yl)-dimethylsilane.
Molecular Properties
| Compound Name | (3-tert-butyl-5-chloro-2-methoxyphenyl)-(1,2-dimethylcyclopenta-2,4-dien-1-yl)-dimethylsilane |
| PubChem CID | 139784661 |
| Molecular Formula | C20H29ClOSi |
| Molecular Weight | 348.99 g/mol |
| Exact Mass | 348.17 |
| IUPAC Name | (3-tert-butyl-5-chloro-2-methoxyphenyl)-(1,2-dimethylcyclopenta-2,4-dien-1-yl)-dimethylsilane |
| SMILES | COc1c(C(C)(C)C)cc(Cl)cc1[Si](C)(C)C1(C)C=CC=C1C |
| InChI | InChI=1S/C20H29ClOSi/c1-14-10-9-11-20(14,5)23(7,8)17-13-15(21)12-16(18(17)22-6)19(2,3)4/h9-13H,1-8H3 |
| InChIKey | YMNZFKPXZXWMAU-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 348.99 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze (3-tert-butyl-5-chloro-2-methoxyphenyl)-(1,2-dimethylcyclopenta-2,4-dien-1-yl)-dimethylsilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-tert-butyl-5-chloro-2-methoxyphenyl)-(1,2-dimethylcyclopenta-2,4-dien-1-yl)-dimethylsilane?
The IUPAC name of (3-tert-butyl-5-chloro-2-methoxyphenyl)-(1,2-dimethylcyclopenta-2,4-dien-1-yl)-dimethylsilane (CID 139784661) is (3-tert-butyl-5-chloro-2-methoxyphenyl)-(1,2-dimethylcyclopenta-2,4-dien-1-yl)-dimethylsilane.
What is the SMILES notation for (3-tert-butyl-5-chloro-2-methoxyphenyl)-(1,2-dimethylcyclopenta-2,4-dien-1-yl)-dimethylsilane?
The canonical SMILES for (3-tert-butyl-5-chloro-2-methoxyphenyl)-(1,2-dimethylcyclopenta-2,4-dien-1-yl)-dimethylsilane is COc1c(C(C)(C)C)cc(Cl)cc1[Si](C)(C)C1(C)C=CC=C1C.
What is the InChIKey of (3-tert-butyl-5-chloro-2-methoxyphenyl)-(1,2-dimethylcyclopenta-2,4-dien-1-yl)-dimethylsilane?
The InChIKey is YMNZFKPXZXWMAU-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H29ClOSi/c1-14-10-9-11-20(14,5)23(7,8)17-13-15(21)12-16(18(17)22-6)19(2,3)4/h9-13H,1-8H3.
What are the key properties of (3-tert-butyl-5-chloro-2-methoxyphenyl)-(1,2-dimethylcyclopenta-2,4-dien-1-yl)-dimethylsilane?
(3-tert-butyl-5-chloro-2-methoxyphenyl)-(1,2-dimethylcyclopenta-2,4-dien-1-yl)-dimethylsilane has a molecular weight of 348.99 g/mol, XLogP of 5.84, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (3-tert-butyl-5-chloro-2-methoxyphenyl)-(1,2-dimethylcyclopenta-2,4-dien-1-yl)-dimethylsilane is sourced from PubChem (CID 139784661), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).