C18H18O3 — CID 139785095
methyl (2E,4E)-2-methoxy-5-naphthalen-2-ylhexa-2,4-dienoate (PubChem CID 139785095) has the molecular formula C18H18O3 and a molecular weight of 282.34 g/mol. Its IUPAC name is methyl (2E,4E)-2-methoxy-5-naphthalen-2-ylhexa-2,4-dienoate.
| Compound Name | methyl (2E,4E)-2-methoxy-5-naphthalen-2-ylhexa-2,4-dienoate |
|---|---|
| PubChem CID | 139785095 |
| Molecular Formula | C18H18O3 |
| Molecular Weight | 282.34 g/mol |
| Exact Mass | 282.13 |
| IUPAC Name | methyl (2E,4E)-2-methoxy-5-naphthalen-2-ylhexa-2,4-dienoate |
| SMILES | COC(=O)/C(=C\C=C(/C)c1ccc2ccccc2c1)OC |
| InChI | InChI=1S/C18H18O3/c1-13(8-11-17(20-2)18(19)21-3)15-10-9-14-6-4-5-7-16(14)12-15/h4-12H,1-3H3/b13-8+,17-11+ |
| InChIKey | HXLFUBYDOUBHHT-GVIPYJQZSA-N |
| XLogP | 3.95 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.34 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|