About [2,4-dimethyl-5-(4-methylthiophen-2-yl)thiophen-3-yl] carbamate
[2,4-dimethyl-5-(4-methylthiophen-2-yl)thiophen-3-yl] carbamate (PubChem CID 139785113) has the molecular formula C12H13NO2S2
and a molecular weight of 267.38 g/mol. Its IUPAC name is [2,4-dimethyl-5-(4-methylthiophen-2-yl)thiophen-3-yl] carbamate.
Molecular Properties
| Compound Name | [2,4-dimethyl-5-(4-methylthiophen-2-yl)thiophen-3-yl] carbamate |
| PubChem CID | 139785113 |
| Molecular Formula | C12H13NO2S2 |
| Molecular Weight | 267.38 g/mol |
| Exact Mass | 267.04 |
| IUPAC Name | [2,4-dimethyl-5-(4-methylthiophen-2-yl)thiophen-3-yl] carbamate |
| SMILES | Cc1csc(-c2sc(C)c(OC(N)=O)c2C)c1 |
| InChI | InChI=1S/C12H13NO2S2/c1-6-4-9(16-5-6)11-7(2)10(8(3)17-11)15-12(13)14/h4-5H,1-3H3,(H2,13,14) |
| InChIKey | SYWVUQGUDIZXHT-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 267.38 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [2,4-dimethyl-5-(4-methylthiophen-2-yl)thiophen-3-yl] carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2,4-dimethyl-5-(4-methylthiophen-2-yl)thiophen-3-yl] carbamate?
The IUPAC name of [2,4-dimethyl-5-(4-methylthiophen-2-yl)thiophen-3-yl] carbamate (CID 139785113) is [2,4-dimethyl-5-(4-methylthiophen-2-yl)thiophen-3-yl] carbamate.
What is the SMILES notation for [2,4-dimethyl-5-(4-methylthiophen-2-yl)thiophen-3-yl] carbamate?
The canonical SMILES for [2,4-dimethyl-5-(4-methylthiophen-2-yl)thiophen-3-yl] carbamate is Cc1csc(-c2sc(C)c(OC(N)=O)c2C)c1.
What is the InChIKey of [2,4-dimethyl-5-(4-methylthiophen-2-yl)thiophen-3-yl] carbamate?
The InChIKey is SYWVUQGUDIZXHT-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H13NO2S2/c1-6-4-9(16-5-6)11-7(2)10(8(3)17-11)15-12(13)14/h4-5H,1-3H3,(H2,13,14).
What are the key properties of [2,4-dimethyl-5-(4-methylthiophen-2-yl)thiophen-3-yl] carbamate?
[2,4-dimethyl-5-(4-methylthiophen-2-yl)thiophen-3-yl] carbamate has a molecular weight of 267.38 g/mol, XLogP of 3.86, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [2,4-dimethyl-5-(4-methylthiophen-2-yl)thiophen-3-yl] carbamate is sourced from PubChem (CID 139785113), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).