C23H18F2N2O2 — CID 139785538
1-[4-[4-[2-(2,6-difluorophenyl)-4,5-dihydro-1,3-oxazol-4-yl]phenyl]phenyl]-N-methoxymethanimine (PubChem CID 139785538) has the molecular formula C23H18F2N2O2 and a molecular weight of 392.41 g/mol. Its IUPAC name is 1-[4-[4-[2-(2,6-difluorophenyl)-4,5-dihydro-1,3-oxazol-4-yl]phenyl]phenyl]-N-methoxymethanimine.
| Compound Name | 1-[4-[4-[2-(2,6-difluorophenyl)-4,5-dihydro-1,3-oxazol-4-yl]phenyl]phenyl]-N-methoxymethanimine |
|---|---|
| PubChem CID | 139785538 |
| Molecular Formula | C23H18F2N2O2 |
| Molecular Weight | 392.41 g/mol |
| Exact Mass | 392.13 |
| IUPAC Name | 1-[4-[4-[2-(2,6-difluorophenyl)-4,5-dihydro-1,3-oxazol-4-yl]phenyl]phenyl]-N-methoxymethanimine |
| SMILES | CON=Cc1ccc(-c2ccc(C3COC(c4c(F)cccc4F)=N3)cc2)cc1 |
| InChI | InChI=1S/C23H18F2N2O2/c1-28-26-13-15-5-7-16(8-6-15)17-9-11-18(12-10-17)21-14-29-23(27-21)22-19(24)3-2-4-20(22)25/h2-13,21H,14H2,1H3 |
| InChIKey | NDWXQPKJZXSMOA-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 43.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.41 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|