C11H8N2S — CID 139785568
4-thia-9,14-diazatricyclo[8.4.0.03,7]tetradeca-1(10),2,6,8,11,13-hexaene (PubChem CID 139785568) has the molecular formula C11H8N2S and a molecular weight of 200.27 g/mol. Its IUPAC name is 4-thia-9,14-diazatricyclo[8.4.0.03,7]tetradeca-1(10),2,6,8,11,13-hexaene.
| Compound Name | 4-thia-9,14-diazatricyclo[8.4.0.03,7]tetradeca-1(10),2,6,8,11,13-hexaene |
|---|---|
| PubChem CID | 139785568 |
| Molecular Formula | C11H8N2S |
| Molecular Weight | 200.27 g/mol |
| Exact Mass | 200.04 |
| IUPAC Name | 4-thia-9,14-diazatricyclo[8.4.0.03,7]tetradeca-1(10),2,6,8,11,13-hexaene |
| SMILES | C1=Nc2cccnc2C=C2SCC=C12 |
| InChI | InChI=1S/C11H8N2S/c1-2-9-10(12-4-1)6-11-8(7-13-9)3-5-14-11/h1-4,6-7H,5H2 |
| InChIKey | QHFIXKMWAKOVBN-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 25.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.27 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |