C9H11F3O4 — CID 139785703
ethyl 3-acetyloxy-4,4,4-trifluoro-2-methylbut-2-enoate (PubChem CID 139785703) has the molecular formula C9H11F3O4 and a molecular weight of 240.18 g/mol. Its IUPAC name is ethyl 3-acetyloxy-4,4,4-trifluoro-2-methylbut-2-enoate.
| Compound Name | ethyl 3-acetyloxy-4,4,4-trifluoro-2-methylbut-2-enoate |
|---|---|
| PubChem CID | 139785703 |
| Molecular Formula | C9H11F3O4 |
| Molecular Weight | 240.18 g/mol |
| Exact Mass | 240.06 |
| IUPAC Name | ethyl 3-acetyloxy-4,4,4-trifluoro-2-methylbut-2-enoate |
| SMILES | CCOC(=O)C(C)=C(OC(C)=O)C(F)(F)F |
| InChI | InChI=1S/C9H11F3O4/c1-4-15-8(14)5(2)7(9(10,11)12)16-6(3)13/h4H2,1-3H3 |
| InChIKey | MNTTYXZPZAHMTM-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.18 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|