C12H15NO3 — CID 139785747
N-(1-hydroxy-2-methylpropan-2-yl)-1-[6-(oxomethylidene)cyclohexa-2,4-dien-1-yl]methanimine oxide (PubChem CID 139785747) has the molecular formula C12H15NO3 and a molecular weight of 221.26 g/mol. Its IUPAC name is N-(1-hydroxy-2-methylpropan-2-yl)-1-[6-(oxomethylidene)cyclohexa-2,4-dien-1-yl]methanimine oxide.
| Compound Name | N-(1-hydroxy-2-methylpropan-2-yl)-1-[6-(oxomethylidene)cyclohexa-2,4-dien-1-yl]methanimine oxide |
|---|---|
| PubChem CID | 139785747 |
| Molecular Formula | C12H15NO3 |
| Molecular Weight | 221.26 g/mol |
| Exact Mass | 221.11 |
| IUPAC Name | N-(1-hydroxy-2-methylpropan-2-yl)-1-[6-(oxomethylidene)cyclohexa-2,4-dien-1-yl]methanimine oxide |
| SMILES | CC(C)(CO)[N+]([O-])=CC1C=CC=CC1=C=O |
| InChI | InChI=1S/C12H15NO3/c1-12(2,9-15)13(16)7-10-5-3-4-6-11(10)8-14/h3-7,10,15H,9H2,1-2H3 |
| InChIKey | AUEYIQRBWZEORW-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 63.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.26 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'ketene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|