C42H41F3O6S2 — CID 139785776
[bis[4-[(2-methylpropan-2-yl)oxy]phenyl]-[4-(phenanthren-9-ylmethoxy)phenyl]-λ4-sulfanyl] trifluoromethanesulfonate (PubChem CID 139785776) has the molecular formula C42H41F3O6S2 and a molecular weight of 762.91 g/mol. Its IUPAC name is [bis[4-[(2-methylpropan-2-yl)oxy]phenyl]-[4-(phenanthren-9-ylmethoxy)phenyl]-λ4-sulfanyl] trifluoromethanesulfonate.
| Compound Name | [bis[4-[(2-methylpropan-2-yl)oxy]phenyl]-[4-(phenanthren-9-ylmethoxy)phenyl]-λ4-sulfanyl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 139785776 |
| Molecular Formula | C42H41F3O6S2 |
| Molecular Weight | 762.91 g/mol |
| Exact Mass | 762.23 |
| IUPAC Name | [bis[4-[(2-methylpropan-2-yl)oxy]phenyl]-[4-(phenanthren-9-ylmethoxy)phenyl]-λ4-sulfanyl] trifluoromethanesulfonate |
| SMILES | CC(C)(C)Oc1ccc(S(OS(=O)(=O)C(F)(F)F)(c2ccc(OCc3cc4ccccc4c4ccccc34)cc2)c2ccc(OC(C)(C)C)cc2)cc1 |
| InChI | InChI=1S/C42H41F3O6S2/c1-40(2,3)49-32-17-23-35(24-18-32)52(51-53(46,47)42(43,44)45,36-25-19-33(20-26-36)50-41(4,5)6)34-21-15-31(16-22-34)48-28-30-27-29-11-7-8-12-37(29)39-14-10-9-13-38(30)39/h7-27H,28H2,1-6H3 |
| InChIKey | XRDXAKDBKMKVTC-UHFFFAOYSA-N |
| XLogP | 11.99 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 762.91 |
| LogP ≤ 5 | 11.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|